5-[(Z)-(5-Fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid - Names and Identifiers
Name | 5-((Z)-(5-Fluoro-2-oxoindolin-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid
|
Synonyms | Des-N-(2-Diethylaminoethyl)amide Sunitinib Acid 5-((Z)-(5-Fluoro-2-oxoindolin-3-ylidene)methyl)-2,4-dimethyl... (Z)-5-[(5-Fluoro-2-oxoindolin-3-ylidene)methyl]-2,4-dimethylpyrrole-3-carboxylic Acid (Z)-5-((5-fluoro-2-oxoindolin-3-ylidene)Methyl)-2,4-diMethyl-1H-pyrrole-3-carboxylic acid 5-((Z)-(5-Fluoro-2-oxoindolin-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (3Z)-3-[(3,5-Dimethyl-4-carboxy-1H-pyrrol-2-yl)methylidene]-5-fluoro-1,3-dihydro-2H-indol-2-on (3Z)-3-[(3,5-DiMethyl-4-carboxy-1H-pyrrol-2-yl)Methylidene]-5-fluoro-1,3-dihydro-2H-indol-2-one 5-[(Z)-(5-Fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid 1H-Pyrrole-3-carboxylic acid, 5-[(Z)-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-2,4-dimethyl- 1H-pyrrole-3-carboxylic acid, 5-[(Z)-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-2,4-dimethyl-
|
CAS | 356068-93-4
|
EINECS | 1592732-453-0 |
InChI | InChI=1/C16H13FN2O3/c1-7-13(18-8(2)14(7)16(21)22)6-11-10-5-9(17)3-4-12(10)19-15(11)20/h3-6,18H,1-2H3,(H,19,20)(H,21,22)/b11-6- |
5-[(Z)-(5-Fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid - Physico-chemical Properties
Molecular Formula | C16H13FN2O3
|
Molar Mass | 300.28 |
Density | 1.454±0.06 g/cm3(Predicted) |
Melting Point | 320 °C (decomp) |
Boling Point | 588.4±50.0 °C(Predicted) |
Flash Point | 309.683°C |
Solubility | Aqueous Base (Slightly, Heated), DMSO (Slightly, Heated) |
Vapor Presure | 0mmHg at 25°C |
Appearance | Solid |
Color | Dark Orange |
pKa | 5.79±0.50(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.69 |
Use | This product is for scientific research only and shall not be used for other purposes. |
5-[(Z)-(5-Fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid - Introduction
5-((Z)-(-) methyl)-2,-acid is an organic compound with the following properties:
1. appearance: solid or powder substance.
2. molecular formula: C15H12FN3O3.
3. Molecular weight: 305.27g/mol.
4. Solubility: Slightly soluble in water, soluble in organic solvents such as dimethyl sulfoxide, methanol and ethanol.
5. melting point: about 180-182 ℃.
The main uses of this compound include:
1. pharmaceutical field: can be used for the synthesis of various drugs, such as anti-inflammatory drugs and anti-tumor drugs.
2. chemical research: can be used as an important intermediate in organic synthesis.
Preparation Method:
The compound can usually be prepared by the following steps:
1. 2,4-dimethyl-1H-pyrrole-3-carboxylic acid is reacted with an appropriate aryl quaternary ammonium salt under basic conditions to obtain an N-aryl substrate.
2. the N-aryl substrate and 5-fluoro -2-oxo-indolane reaction to generate the target product.
Safety Information:
1. This compound should follow chemical safety procedures during handling and storage, and avoid contact with skin, eyes and clothing.
2. Avoid inhaling dust from compounds and operate in a well-ventilated environment.
3. If contact occurs, immediately flush the affected area with plenty of water and seek medical assistance.
4. The compound may be harmful to the environment, and the waste should be properly disposed of in accordance with relevant regulations.
Last Update:2024-04-09 02:00:45